C12H19F2NO2 — CID 141392295
(5R)-3,3-difluoro-5-[(E,3S)-3-hydroxyoct-1-enyl]pyrrolidin-2-one (PubChem CID 141392295) has the molecular formula C12H19F2NO2 and a molecular weight of 247.28 g/mol. Its IUPAC name is (5R)-3,3-difluoro-5-[(E,3S)-3-hydroxyoct-1-enyl]pyrrolidin-2-one.
| Compound Name | (5R)-3,3-difluoro-5-[(E,3S)-3-hydroxyoct-1-enyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 141392295 |
| Molecular Formula | C12H19F2NO2 |
| Molecular Weight | 247.28 g/mol |
| Exact Mass | 247.14 |
| IUPAC Name | (5R)-3,3-difluoro-5-[(E,3S)-3-hydroxyoct-1-enyl]pyrrolidin-2-one |
| SMILES | CCCCC[C@H](O)/C=C/[C@H]1CC(F)(F)C(=O)N1 |
| InChI | InChI=1S/C12H19F2NO2/c1-2-3-4-5-10(16)7-6-9-8-12(13,14)11(17)15-9/h6-7,9-10,16H,2-5,8H2,1H3,(H,15,17)/b7-6+/t9-,10-/m0/s1 |
| InChIKey | CMHIHKOEGDWOAA-CAFLDADYSA-N |
| XLogP | 2.01 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.28 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|