C15H21F2NO2 — CID 141392313
(5R)-3,3-difluoro-5-[(E,3S,4S)-3-hydroxy-4-methyldec-1-en-6-ynyl]pyrrolidin-2-one (PubChem CID 141392313) has the molecular formula C15H21F2NO2 and a molecular weight of 285.33 g/mol. Its IUPAC name is (5R)-3,3-difluoro-5-[(E,3S,4S)-3-hydroxy-4-methyldec-1-en-6-ynyl]pyrrolidin-2-one.
| Compound Name | (5R)-3,3-difluoro-5-[(E,3S,4S)-3-hydroxy-4-methyldec-1-en-6-ynyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 141392313 |
| Molecular Formula | C15H21F2NO2 |
| Molecular Weight | 285.33 g/mol |
| Exact Mass | 285.15 |
| IUPAC Name | (5R)-3,3-difluoro-5-[(E,3S,4S)-3-hydroxy-4-methyldec-1-en-6-ynyl]pyrrolidin-2-one |
| SMILES | CCCC#CC[C@H](C)[C@H](O)/C=C/[C@H]1CC(F)(F)C(=O)N1 |
| InChI | InChI=1S/C15H21F2NO2/c1-3-4-5-6-7-11(2)13(19)9-8-12-10-15(16,17)14(20)18-12/h8-9,11-13,19H,3-4,7,10H2,1-2H3,(H,18,20)/b9-8+/t11-,12-,13+/m0/s1 |
| InChIKey | BRVQBAABWLNDMS-HFCZWNMXSA-N |
| XLogP | 2.26 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.33 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|