C12H18N4O — CID 141392386
2-[(3aS,6aR)-5-pyridazin-3-yl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]ethanol (PubChem CID 141392386) has the molecular formula C12H18N4O and a molecular weight of 234.30 g/mol. Its IUPAC name is 2-[(3aS,6aR)-5-pyridazin-3-yl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]ethanol.
| Compound Name | 2-[(3aS,6aR)-5-pyridazin-3-yl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]ethanol |
|---|---|
| PubChem CID | 141392386 |
| Molecular Formula | C12H18N4O |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.15 |
| IUPAC Name | 2-[(3aS,6aR)-5-pyridazin-3-yl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]ethanol |
| SMILES | OCCN1C[C@@H]2CN(c3cccnn3)C[C@@H]2C1 |
| InChI | InChI=1S/C12H18N4O/c17-5-4-15-6-10-8-16(9-11(10)7-15)12-2-1-3-13-14-12/h1-3,10-11,17H,4-9H2/t10-,11+ |
| InChIKey | WUZICYZMZWKJCJ-PHIMTYICSA-N |
| XLogP | -0.16 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |