C23H27Cl2N5 — CID 141392523
3-N-[(2,6-dichlorophenyl)methyl]-5-[3-[2-(2-methylpropylamino)ethyl]phenyl]pyrazine-2,3-diamine (PubChem CID 141392523) has the molecular formula C23H27Cl2N5 and a molecular weight of 444.41 g/mol. Its IUPAC name is 3-N-[(2,6-dichlorophenyl)methyl]-5-[3-[2-(2-methylpropylamino)ethyl]phenyl]pyrazine-2,3-diamine.
| Compound Name | 3-N-[(2,6-dichlorophenyl)methyl]-5-[3-[2-(2-methylpropylamino)ethyl]phenyl]pyrazine-2,3-diamine |
|---|---|
| PubChem CID | 141392523 |
| Molecular Formula | C23H27Cl2N5 |
| Molecular Weight | 444.41 g/mol |
| Exact Mass | 443.16 |
| IUPAC Name | 3-N-[(2,6-dichlorophenyl)methyl]-5-[3-[2-(2-methylpropylamino)ethyl]phenyl]pyrazine-2,3-diamine |
| SMILES | CC(C)CNCCc1cccc(-c2cnc(N)c(NCc3c(Cl)cccc3Cl)n2)c1 |
| InChI | InChI=1S/C23H27Cl2N5/c1-15(2)12-27-10-9-16-5-3-6-17(11-16)21-14-28-22(26)23(30-21)29-13-18-19(24)7-4-8-20(18)25/h3-8,11,14-15,27H,9-10,12-13H2,1-2H3,(H2,26,28)(H,29,30) |
| InChIKey | FKUBSMMZYZQBJS-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.41 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|