About 2-hydroxy-N,4-dimethyl-6-oxo-1H-pyridine-3-carboxamide
2-hydroxy-N,4-dimethyl-6-oxo-1H-pyridine-3-carboxamide (PubChem CID 141392764) has the molecular formula C8H10N2O3
and a molecular weight of 182.18 g/mol. Its IUPAC name is 2-hydroxy-N,4-dimethyl-6-oxo-1H-pyridine-3-carboxamide.
Molecular Properties
| Compound Name | 2-hydroxy-N,4-dimethyl-6-oxo-1H-pyridine-3-carboxamide |
| PubChem CID | 141392764 |
| Molecular Formula | C8H10N2O3 |
| Molecular Weight | 182.18 g/mol |
| Exact Mass | 182.07 |
| IUPAC Name | 2-hydroxy-N,4-dimethyl-6-oxo-1H-pyridine-3-carboxamide |
| SMILES | CNC(=O)c1c(C)cc(=O)[nH]c1O |
| InChI | InChI=1S/C8H10N2O3/c1-4-3-5(11)10-8(13)6(4)7(12)9-2/h3H,1-2H3,(H,9,12)(H2,10,11,13) |
| InChIKey | IVRAKYWWLDSGMG-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.18 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-hydroxy-N,4-dimethyl-6-oxo-1H-pyridine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxy-N,4-dimethyl-6-oxo-1H-pyridine-3-carboxamide?
The IUPAC name of 2-hydroxy-N,4-dimethyl-6-oxo-1H-pyridine-3-carboxamide (CID 141392764) is 2-hydroxy-N,4-dimethyl-6-oxo-1H-pyridine-3-carboxamide.
What is the SMILES notation for 2-hydroxy-N,4-dimethyl-6-oxo-1H-pyridine-3-carboxamide?
The canonical SMILES for 2-hydroxy-N,4-dimethyl-6-oxo-1H-pyridine-3-carboxamide is CNC(=O)c1c(C)cc(=O)[nH]c1O.
What is the InChIKey of 2-hydroxy-N,4-dimethyl-6-oxo-1H-pyridine-3-carboxamide?
The InChIKey is IVRAKYWWLDSGMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2O3/c1-4-3-5(11)10-8(13)6(4)7(12)9-2/h3H,1-2H3,(H,9,12)(H2,10,11,13).
What are the key properties of 2-hydroxy-N,4-dimethyl-6-oxo-1H-pyridine-3-carboxamide?
2-hydroxy-N,4-dimethyl-6-oxo-1H-pyridine-3-carboxamide has a molecular weight of 182.18 g/mol, XLogP of -0.25, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-N,4-dimethyl-6-oxo-1H-pyridine-3-carboxamide is sourced from PubChem (CID 141392764), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).