C30H62 — CID 14139292
2,6,10,14,18-pentamethyl-7-(3-methylpentyl)nonadecane (PubChem CID 14139292) has the molecular formula C30H62 and a molecular weight of 422.83 g/mol. Its IUPAC name is 2,6,10,14,18-pentamethyl-7-(3-methylpentyl)nonadecane.
| Compound Name | 2,6,10,14,18-pentamethyl-7-(3-methylpentyl)nonadecane |
|---|---|
| PubChem CID | 14139292 |
| Molecular Formula | C30H62 |
| Molecular Weight | 422.83 g/mol |
| Exact Mass | 422.49 |
| IUPAC Name | 2,6,10,14,18-pentamethyl-7-(3-methylpentyl)nonadecane |
| SMILES | CCC(C)CCC(CCC(C)CCCC(C)CCCC(C)C)C(C)CCCC(C)C |
| InChI | InChI=1S/C30H62/c1-10-26(6)20-22-30(29(9)19-12-15-25(4)5)23-21-28(8)18-13-17-27(7)16-11-14-24(2)3/h24-30H,10-23H2,1-9H3 |
| InChIKey | ZYUQNRLZGGWDML-UHFFFAOYSA-N |
| XLogP | 10.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 20 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.83 |
| LogP ≤ 5 | 10.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |