About 2,3-diethoxyhept-2-ene
2,3-diethoxyhept-2-ene (PubChem CID 141393119) has the molecular formula C11H22O2
and a molecular weight of 186.29 g/mol. Its IUPAC name is 2,3-diethoxyhept-2-ene.
Molecular Properties
| Compound Name | 2,3-diethoxyhept-2-ene |
| PubChem CID | 141393119 |
| Molecular Formula | C11H22O2 |
| Molecular Weight | 186.29 g/mol |
| Exact Mass | 186.16 |
| IUPAC Name | 2,3-diethoxyhept-2-ene |
| SMILES | CCCCC(OCC)=C(C)OCC |
| InChI | InChI=1S/C11H22O2/c1-5-8-9-11(13-7-3)10(4)12-6-2/h5-9H2,1-4H3 |
| InChIKey | HAFRTNOUGVPHSD-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.29 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 2,3-diethoxyhept-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-diethoxyhept-2-ene?
The IUPAC name of 2,3-diethoxyhept-2-ene (CID 141393119) is 2,3-diethoxyhept-2-ene.
What is the SMILES notation for 2,3-diethoxyhept-2-ene?
The canonical SMILES for 2,3-diethoxyhept-2-ene is CCCCC(OCC)=C(C)OCC.
What is the InChIKey of 2,3-diethoxyhept-2-ene?
The InChIKey is HAFRTNOUGVPHSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22O2/c1-5-8-9-11(13-7-3)10(4)12-6-2/h5-9H2,1-4H3.
What are the key properties of 2,3-diethoxyhept-2-ene?
2,3-diethoxyhept-2-ene has a molecular weight of 186.29 g/mol, XLogP of 3.48, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-diethoxyhept-2-ene is sourced from PubChem (CID 141393119), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).