About 7-bromo-1-[4-(2-bromoethynyl)-1,3-dimethylcyclohexa-2,4-dien-1-yl]sulfonylindole
7-bromo-1-[4-(2-bromoethynyl)-1,3-dimethylcyclohexa-2,4-dien-1-yl]sulfonylindole (PubChem CID 141393380) has the molecular formula C18H15Br2NO2S
and a molecular weight of 469.20 g/mol. Its IUPAC name is 7-bromo-1-[4-(2-bromoethynyl)-1,3-dimethylcyclohexa-2,4-dien-1-yl]sulfonylindole.
Molecular Properties
| Compound Name | 7-bromo-1-[4-(2-bromoethynyl)-1,3-dimethylcyclohexa-2,4-dien-1-yl]sulfonylindole |
| PubChem CID | 141393380 |
| Molecular Formula | C18H15Br2NO2S |
| Molecular Weight | 469.20 g/mol |
| Exact Mass | 466.92 |
| IUPAC Name | 7-bromo-1-[4-(2-bromoethynyl)-1,3-dimethylcyclohexa-2,4-dien-1-yl]sulfonylindole |
| SMILES | CC1=CC(C)(S(=O)(=O)n2ccc3cccc(Br)c32)CC=C1C#CBr |
| InChI | InChI=1S/C18H15Br2NO2S/c1-13-12-18(2,9-6-14(13)7-10-19)24(22,23)21-11-8-15-4-3-5-16(20)17(15)21/h3-6,8,11-12H,9H2,1-2H3 |
| InChIKey | ILNIXELBDKDULK-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 469.20 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 7-bromo-1-[4-(2-bromoethynyl)-1,3-dimethylcyclohexa-2,4-dien-1-yl]sulfonylindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-bromo-1-[4-(2-bromoethynyl)-1,3-dimethylcyclohexa-2,4-dien-1-yl]sulfonylindole?
The IUPAC name of 7-bromo-1-[4-(2-bromoethynyl)-1,3-dimethylcyclohexa-2,4-dien-1-yl]sulfonylindole (CID 141393380) is 7-bromo-1-[4-(2-bromoethynyl)-1,3-dimethylcyclohexa-2,4-dien-1-yl]sulfonylindole.
What is the SMILES notation for 7-bromo-1-[4-(2-bromoethynyl)-1,3-dimethylcyclohexa-2,4-dien-1-yl]sulfonylindole?
The canonical SMILES for 7-bromo-1-[4-(2-bromoethynyl)-1,3-dimethylcyclohexa-2,4-dien-1-yl]sulfonylindole is CC1=CC(C)(S(=O)(=O)n2ccc3cccc(Br)c32)CC=C1C#CBr.
What is the InChIKey of 7-bromo-1-[4-(2-bromoethynyl)-1,3-dimethylcyclohexa-2,4-dien-1-yl]sulfonylindole?
The InChIKey is ILNIXELBDKDULK-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15Br2NO2S/c1-13-12-18(2,9-6-14(13)7-10-19)24(22,23)21-11-8-15-4-3-5-16(20)17(15)21/h3-6,8,11-12H,9H2,1-2H3.
What are the key properties of 7-bromo-1-[4-(2-bromoethynyl)-1,3-dimethylcyclohexa-2,4-dien-1-yl]sulfonylindole?
7-bromo-1-[4-(2-bromoethynyl)-1,3-dimethylcyclohexa-2,4-dien-1-yl]sulfonylindole has a molecular weight of 469.20 g/mol, XLogP of 4.97, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-bromo-1-[4-(2-bromoethynyl)-1,3-dimethylcyclohexa-2,4-dien-1-yl]sulfonylindole is sourced from PubChem (CID 141393380), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).