About 2-cyclohexyl-1,5-dihydropyrazole
2-cyclohexyl-1,5-dihydropyrazole (PubChem CID 141393847) has the molecular formula C9H16N2
and a molecular weight of 152.24 g/mol. Its IUPAC name is 2-cyclohexyl-1,5-dihydropyrazole.
Molecular Properties
| Compound Name | 2-cyclohexyl-1,5-dihydropyrazole |
| PubChem CID | 141393847 |
| Molecular Formula | C9H16N2 |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.13 |
| IUPAC Name | 2-cyclohexyl-1,5-dihydropyrazole |
| SMILES | C1=CN(C2CCCCC2)NC1 |
| InChI | InChI=1S/C9H16N2/c1-2-5-9(6-3-1)11-8-4-7-10-11/h4,8-10H,1-3,5-7H2 |
| InChIKey | TUQGLDIAWHHNIP-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-cyclohexyl-1,5-dihydropyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclohexyl-1,5-dihydropyrazole?
The IUPAC name of 2-cyclohexyl-1,5-dihydropyrazole (CID 141393847) is 2-cyclohexyl-1,5-dihydropyrazole.
What is the SMILES notation for 2-cyclohexyl-1,5-dihydropyrazole?
The canonical SMILES for 2-cyclohexyl-1,5-dihydropyrazole is C1=CN(C2CCCCC2)NC1.
What is the InChIKey of 2-cyclohexyl-1,5-dihydropyrazole?
The InChIKey is TUQGLDIAWHHNIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N2/c1-2-5-9(6-3-1)11-8-4-7-10-11/h4,8-10H,1-3,5-7H2.
What are the key properties of 2-cyclohexyl-1,5-dihydropyrazole?
2-cyclohexyl-1,5-dihydropyrazole has a molecular weight of 152.24 g/mol, XLogP of 1.65, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclohexyl-1,5-dihydropyrazole is sourced from PubChem (CID 141393847), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).