C7H11N3 — CID 141394248
1,3,4,5-tetrahydroindazol-2-amine (PubChem CID 141394248) has the molecular formula C7H11N3 and a molecular weight of 137.19 g/mol. Its IUPAC name is 1,3,4,5-tetrahydroindazol-2-amine.
| Compound Name | 1,3,4,5-tetrahydroindazol-2-amine |
|---|---|
| PubChem CID | 141394248 |
| Molecular Formula | C7H11N3 |
| Molecular Weight | 137.19 g/mol |
| Exact Mass | 137.10 |
| IUPAC Name | 1,3,4,5-tetrahydroindazol-2-amine |
| SMILES | NN1CC2=C(C=CCC2)N1 |
| InChI | InChI=1S/C7H11N3/c8-10-5-6-3-1-2-4-7(6)9-10/h2,4,9H,1,3,5,8H2 |
| InChIKey | NOZLWCCOMNAXAP-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.19 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|