About 3-methyl-N-(1,2,4-triazol-1-yl)benzotriazol-5-amine
3-methyl-N-(1,2,4-triazol-1-yl)benzotriazol-5-amine (PubChem CID 141394403) has the molecular formula C9H9N7
and a molecular weight of 215.22 g/mol. Its IUPAC name is 3-methyl-N-(1,2,4-triazol-1-yl)benzotriazol-5-amine.
Molecular Properties
| Compound Name | 3-methyl-N-(1,2,4-triazol-1-yl)benzotriazol-5-amine |
| PubChem CID | 141394403 |
| Molecular Formula | C9H9N7 |
| Molecular Weight | 215.22 g/mol |
| Exact Mass | 215.09 |
| IUPAC Name | 3-methyl-N-(1,2,4-triazol-1-yl)benzotriazol-5-amine |
| SMILES | Cn1nnc2ccc(Nn3cncn3)cc21 |
| InChI | InChI=1S/C9H9N7/c1-15-9-4-7(2-3-8(9)12-14-15)13-16-6-10-5-11-16/h2-6,13H,1H3 |
| InChIKey | QHODVJNFRHJAQA-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 73.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.22 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 3-methyl-N-(1,2,4-triazol-1-yl)benzotriazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-N-(1,2,4-triazol-1-yl)benzotriazol-5-amine?
The IUPAC name of 3-methyl-N-(1,2,4-triazol-1-yl)benzotriazol-5-amine (CID 141394403) is 3-methyl-N-(1,2,4-triazol-1-yl)benzotriazol-5-amine.
What is the SMILES notation for 3-methyl-N-(1,2,4-triazol-1-yl)benzotriazol-5-amine?
The canonical SMILES for 3-methyl-N-(1,2,4-triazol-1-yl)benzotriazol-5-amine is Cn1nnc2ccc(Nn3cncn3)cc21.
What is the InChIKey of 3-methyl-N-(1,2,4-triazol-1-yl)benzotriazol-5-amine?
The InChIKey is QHODVJNFRHJAQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N7/c1-15-9-4-7(2-3-8(9)12-14-15)13-16-6-10-5-11-16/h2-6,13H,1H3.
What are the key properties of 3-methyl-N-(1,2,4-triazol-1-yl)benzotriazol-5-amine?
3-methyl-N-(1,2,4-triazol-1-yl)benzotriazol-5-amine has a molecular weight of 215.22 g/mol, XLogP of 0.44, 2 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-N-(1,2,4-triazol-1-yl)benzotriazol-5-amine is sourced from PubChem (CID 141394403), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).