C23H26FNO6 — CID 141394588
3-[4-[2-[2-[2-(fluoromethoxy)but-3-enoxy]ethoxy]ethoxy]benzoyl]benzamide (PubChem CID 141394588) has the molecular formula C23H26FNO6 and a molecular weight of 431.46 g/mol. Its IUPAC name is 3-[4-[2-[2-[2-(fluoromethoxy)but-3-enoxy]ethoxy]ethoxy]benzoyl]benzamide.
| Compound Name | 3-[4-[2-[2-[2-(fluoromethoxy)but-3-enoxy]ethoxy]ethoxy]benzoyl]benzamide |
|---|---|
| PubChem CID | 141394588 |
| Molecular Formula | C23H26FNO6 |
| Molecular Weight | 431.46 g/mol |
| Exact Mass | 431.17 |
| IUPAC Name | 3-[4-[2-[2-[2-(fluoromethoxy)but-3-enoxy]ethoxy]ethoxy]benzoyl]benzamide |
| SMILES | C=CC(COCCOCCOc1ccc(C(=O)c2cccc(C(N)=O)c2)cc1)OCF |
| InChI | InChI=1S/C23H26FNO6/c1-2-20(31-16-24)15-29-11-10-28-12-13-30-21-8-6-17(7-9-21)22(26)18-4-3-5-19(14-18)23(25)27/h2-9,14,20H,1,10-13,15-16H2,(H2,25,27) |
| InChIKey | RTBAUKJYIPQDKR-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 97.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.46 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|