C17H26O — CID 141394597
1-methoxy-2-[(4-propylcyclohexyl)methyl]benzene (PubChem CID 141394597) has the molecular formula C17H26O and a molecular weight of 246.39 g/mol. Its IUPAC name is 1-methoxy-2-[(4-propylcyclohexyl)methyl]benzene.
| Compound Name | 1-methoxy-2-[(4-propylcyclohexyl)methyl]benzene |
|---|---|
| PubChem CID | 141394597 |
| Molecular Formula | C17H26O |
| Molecular Weight | 246.39 g/mol |
| Exact Mass | 246.20 |
| IUPAC Name | 1-methoxy-2-[(4-propylcyclohexyl)methyl]benzene |
| SMILES | CCCC1CCC(Cc2ccccc2OC)CC1 |
| InChI | InChI=1S/C17H26O/c1-3-6-14-9-11-15(12-10-14)13-16-7-4-5-8-17(16)18-2/h4-5,7-8,14-15H,3,6,9-13H2,1-2H3 |
| InChIKey | QRDDWXUKJZYGHQ-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.39 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |