About 3a-fluoro-1,3,3-trimethyl-4H-indol-2-one
3a-fluoro-1,3,3-trimethyl-4H-indol-2-one (PubChem CID 141394908) has the molecular formula C11H14FNO
and a molecular weight of 195.24 g/mol. Its IUPAC name is 3a-fluoro-1,3,3-trimethyl-4H-indol-2-one.
Molecular Properties
| Compound Name | 3a-fluoro-1,3,3-trimethyl-4H-indol-2-one |
| PubChem CID | 141394908 |
| Molecular Formula | C11H14FNO |
| Molecular Weight | 195.24 g/mol |
| Exact Mass | 195.11 |
| IUPAC Name | 3a-fluoro-1,3,3-trimethyl-4H-indol-2-one |
| SMILES | CN1C(=O)C(C)(C)C2(F)CC=CC=C12 |
| InChI | InChI=1S/C11H14FNO/c1-10(2)9(14)13(3)8-6-4-5-7-11(8,10)12/h4-6H,7H2,1-3H3 |
| InChIKey | VPPUTVQWICGGPS-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.24 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3a-fluoro-1,3,3-trimethyl-4H-indol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3a-fluoro-1,3,3-trimethyl-4H-indol-2-one?
The IUPAC name of 3a-fluoro-1,3,3-trimethyl-4H-indol-2-one (CID 141394908) is 3a-fluoro-1,3,3-trimethyl-4H-indol-2-one.
What is the SMILES notation for 3a-fluoro-1,3,3-trimethyl-4H-indol-2-one?
The canonical SMILES for 3a-fluoro-1,3,3-trimethyl-4H-indol-2-one is CN1C(=O)C(C)(C)C2(F)CC=CC=C12.
What is the InChIKey of 3a-fluoro-1,3,3-trimethyl-4H-indol-2-one?
The InChIKey is VPPUTVQWICGGPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14FNO/c1-10(2)9(14)13(3)8-6-4-5-7-11(8,10)12/h4-6H,7H2,1-3H3.
What are the key properties of 3a-fluoro-1,3,3-trimethyl-4H-indol-2-one?
3a-fluoro-1,3,3-trimethyl-4H-indol-2-one has a molecular weight of 195.24 g/mol, XLogP of 2.04, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3a-fluoro-1,3,3-trimethyl-4H-indol-2-one is sourced from PubChem (CID 141394908), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).