C11H13BrFNO — CID 141394955
6-bromo-5-fluoro-1,3,3-trimethyl-3a,4-dihydroindol-2-one (PubChem CID 141394955) has the molecular formula C11H13BrFNO and a molecular weight of 274.13 g/mol. Its IUPAC name is 6-bromo-5-fluoro-1,3,3-trimethyl-3a,4-dihydroindol-2-one.
| Compound Name | 6-bromo-5-fluoro-1,3,3-trimethyl-3a,4-dihydroindol-2-one |
|---|---|
| PubChem CID | 141394955 |
| Molecular Formula | C11H13BrFNO |
| Molecular Weight | 274.13 g/mol |
| Exact Mass | 273.02 |
| IUPAC Name | 6-bromo-5-fluoro-1,3,3-trimethyl-3a,4-dihydroindol-2-one |
| SMILES | CN1C(=O)C(C)(C)C2CC(F)=C(Br)C=C21 |
| InChI | InChI=1S/C11H13BrFNO/c1-11(2)6-4-8(13)7(12)5-9(6)14(3)10(11)15/h5-6H,4H2,1-3H3 |
| InChIKey | MHJHZSDCFANTBP-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.13 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |