C11H14FNO — CID 141394978
7-fluoro-1,3,3-trimethyl-3a,4-dihydroindol-2-one (PubChem CID 141394978) has the molecular formula C11H14FNO and a molecular weight of 195.24 g/mol. Its IUPAC name is 7-fluoro-1,3,3-trimethyl-3a,4-dihydroindol-2-one.
| Compound Name | 7-fluoro-1,3,3-trimethyl-3a,4-dihydroindol-2-one |
|---|---|
| PubChem CID | 141394978 |
| Molecular Formula | C11H14FNO |
| Molecular Weight | 195.24 g/mol |
| Exact Mass | 195.11 |
| IUPAC Name | 7-fluoro-1,3,3-trimethyl-3a,4-dihydroindol-2-one |
| SMILES | CN1C(=O)C(C)(C)C2CC=CC(F)=C21 |
| InChI | InChI=1S/C11H14FNO/c1-11(2)7-5-4-6-8(12)9(7)13(3)10(11)14/h4,6-7H,5H2,1-3H3 |
| InChIKey | AYWFUZBEXFGCRE-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.24 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |