C30H16Cl4F6OS — CID 141395005
2-(3,5-dichlorophenyl)-1-[2-(3,5-dichlorophenyl)-3-[(E)-3,3,3-trifluoroprop-1-enyl]phenyl]sulfinyl-3-[(E)-3,3,3-trifluoroprop-1-enyl]benzene (PubChem CID 141395005) has the molecular formula C30H16Cl4F6OS and a molecular weight of 680.32 g/mol. Its IUPAC name is 2-(3,5-dichlorophenyl)-1-[2-(3,5-dichlorophenyl)-3-[(E)-3,3,3-trifluoroprop-1-enyl]phenyl]sulfinyl-3-[(E)-3,3,3-trifluoroprop-1-enyl]benzene.
| Compound Name | 2-(3,5-dichlorophenyl)-1-[2-(3,5-dichlorophenyl)-3-[(E)-3,3,3-trifluoroprop-1-enyl]phenyl]sulfinyl-3-[(E)-3,3,3-trifluoroprop-1-enyl]benzene |
|---|---|
| PubChem CID | 141395005 |
| Molecular Formula | C30H16Cl4F6OS |
| Molecular Weight | 680.32 g/mol |
| Exact Mass | 677.96 |
| IUPAC Name | 2-(3,5-dichlorophenyl)-1-[2-(3,5-dichlorophenyl)-3-[(E)-3,3,3-trifluoroprop-1-enyl]phenyl]sulfinyl-3-[(E)-3,3,3-trifluoroprop-1-enyl]benzene |
| SMILES | O=S(c1cccc(/C=C/C(F)(F)F)c1-c1cc(Cl)cc(Cl)c1)c1cccc(/C=C/C(F)(F)F)c1-c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C30H16Cl4F6OS/c31-21-11-19(12-22(32)15-21)27-17(7-9-29(35,36)37)3-1-5-25(27)42(41)26-6-2-4-18(8-10-30(38,39)40)28(26)20-13-23(33)16-24(34)14-20/h1-16H/b9-7+,10-8+ |
| InChIKey | OGNDKFLJOMVTJA-FIFLTTCUSA-N |
| XLogP | 11.95 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.32 |
| LogP ≤ 5 | 11.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |