C34H64O12S2 — CID 141395057
2-[1-[2,3-bis[2-[1-[(2-ethyl-4-methyl-1,3-dioxolan-2-yl)oxy]propoxy]ethylsulfanyl]propoxy]propoxy]-2-ethyl-4-methyl-1,3-dioxolane (PubChem CID 141395057) has the molecular formula C34H64O12S2 and a molecular weight of 729.01 g/mol. Its IUPAC name is 2-[1-[2,3-bis[2-[1-[(2-ethyl-4-methyl-1,3-dioxolan-2-yl)oxy]propoxy]ethylsulfanyl]propoxy]propoxy]-2-ethyl-4-methyl-1,3-dioxolane.
| Compound Name | 2-[1-[2,3-bis[2-[1-[(2-ethyl-4-methyl-1,3-dioxolan-2-yl)oxy]propoxy]ethylsulfanyl]propoxy]propoxy]-2-ethyl-4-methyl-1,3-dioxolane |
|---|---|
| PubChem CID | 141395057 |
| Molecular Formula | C34H64O12S2 |
| Molecular Weight | 729.01 g/mol |
| Exact Mass | 728.38 |
| IUPAC Name | 2-[1-[2,3-bis[2-[1-[(2-ethyl-4-methyl-1,3-dioxolan-2-yl)oxy]propoxy]ethylsulfanyl]propoxy]propoxy]-2-ethyl-4-methyl-1,3-dioxolane |
| SMILES | CCC(OCCSCC(COC(CC)OC1(CC)OCC(C)O1)SCCOC(CC)OC1(CC)OCC(C)O1)OC1(CC)OCC(C)O1 |
| InChI | InChI=1S/C34H64O12S2/c1-10-29(44-32(13-4)38-20-25(7)41-32)35-16-18-47-24-28(23-37-31(12-3)46-34(15-6)40-22-27(9)43-34)48-19-17-36-30(11-2)45-33(14-5)39-21-26(8)42-33/h25-31H,10-24H2,1-9H3 |
| InChIKey | XVPLOUANLCZQFO-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 110.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 729.01 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|