C13H13NO5 — CID 141395280
(8R)-8-phenylmethoxy-6,7,8,8a-tetrahydropyrrolo[1,2-b][1,4,2]dioxazine-2,3-dione (PubChem CID 141395280) has the molecular formula C13H13NO5 and a molecular weight of 263.25 g/mol. Its IUPAC name is (8R)-8-phenylmethoxy-6,7,8,8a-tetrahydropyrrolo[1,2-b][1,4,2]dioxazine-2,3-dione.
| Compound Name | (8R)-8-phenylmethoxy-6,7,8,8a-tetrahydropyrrolo[1,2-b][1,4,2]dioxazine-2,3-dione |
|---|---|
| PubChem CID | 141395280 |
| Molecular Formula | C13H13NO5 |
| Molecular Weight | 263.25 g/mol |
| Exact Mass | 263.08 |
| IUPAC Name | (8R)-8-phenylmethoxy-6,7,8,8a-tetrahydropyrrolo[1,2-b][1,4,2]dioxazine-2,3-dione |
| SMILES | O=C1OC2[C@H](OCc3ccccc3)CCN2OC1=O |
| InChI | InChI=1S/C13H13NO5/c15-12-13(16)19-14-7-6-10(11(14)18-12)17-8-9-4-2-1-3-5-9/h1-5,10-11H,6-8H2/t10-,11?/m1/s1 |
| InChIKey | JGSWWOBQOJXWEC-NFJWQWPMSA-N |
| XLogP | 0.62 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.25 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|