(8-dibenzothiophen-4-yldibenzofuran-2-yl)boronic acid

C24H15BO3S — CID 141395434

IUPAC(8-dibenzothiophen-4-yldibenzofuran-2-yl)boronic acid
SMILESOB(O)c1ccc2oc3ccc(-c4cccc5c4sc4ccccc45)cc3c2c1
InChIInChI=1S/C24H15BO3S/c26-25(27)15-9-11-22-20(13-15)19-12-14(8-10-21(19)28-22)16-5-3-6-18-17-4-1-2-7-23(17)29-24(16)18/h1-13,26-27H
InChIKeyYYDATQATAHMSNT-UHFFFAOYSA-N
MW394.26 g/mol
LogP5.30
Rot. Bonds2

About (8-dibenzothiophen-4-yldibenzofuran-2-yl)boronic acid

(8-dibenzothiophen-4-yldibenzofuran-2-yl)boronic acid (PubChem CID 141395434) has the molecular formula C24H15BO3S and a molecular weight of 394.26 g/mol. Its IUPAC name is (8-dibenzothiophen-4-yldibenzofuran-2-yl)boronic acid.

Molecular Properties

Compound Name(8-dibenzothiophen-4-yldibenzofuran-2-yl)boronic acid
PubChem CID141395434
Molecular FormulaC24H15BO3S
Molecular Weight394.26 g/mol
Exact Mass394.08
IUPAC Name(8-dibenzothiophen-4-yldibenzofuran-2-yl)boronic acid
SMILESOB(O)c1ccc2oc3ccc(-c4cccc5c4sc4ccccc45)cc3c2c1
InChIInChI=1S/C24H15BO3S/c26-25(27)15-9-11-22-20(13-15)19-12-14(8-10-21(19)28-22)16-5-3-6-18-17-4-1-2-7-23(17)29-24(16)18/h1-13,26-27H
InChIKeyYYDATQATAHMSNT-UHFFFAOYSA-N
XLogP5.30
TPSA53.60 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms29
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500394.26
LogP ≤ 55.30
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze (8-dibenzothiophen-4-yldibenzofuran-2-yl)boronic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (8-dibenzothiophen-4-yldibenzofuran-2-yl)boronic acid?
The IUPAC name of (8-dibenzothiophen-4-yldibenzofuran-2-yl)boronic acid (CID 141395434) is (8-dibenzothiophen-4-yldibenzofuran-2-yl)boronic acid.
What is the SMILES notation for (8-dibenzothiophen-4-yldibenzofuran-2-yl)boronic acid?
The canonical SMILES for (8-dibenzothiophen-4-yldibenzofuran-2-yl)boronic acid is OB(O)c1ccc2oc3ccc(-c4cccc5c4sc4ccccc45)cc3c2c1.
What is the InChIKey of (8-dibenzothiophen-4-yldibenzofuran-2-yl)boronic acid?
The InChIKey is YYDATQATAHMSNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H15BO3S/c26-25(27)15-9-11-22-20(13-15)19-12-14(8-10-21(19)28-22)16-5-3-6-18-17-4-1-2-7-23(17)29-24(16)18/h1-13,26-27H.
What are the key properties of (8-dibenzothiophen-4-yldibenzofuran-2-yl)boronic acid?
(8-dibenzothiophen-4-yldibenzofuran-2-yl)boronic acid has a molecular weight of 394.26 g/mol, XLogP of 5.30, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (8-dibenzothiophen-4-yldibenzofuran-2-yl)boronic acid is sourced from PubChem (CID 141395434), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).