C20H33N3O — CID 141395777
1-(3-ethyl-1,2,3,5,6,6a-hexahydrocyclopenta[c]pyrrol-5-yl)-N-(1-methylcyclobutyl)piperidine-4-carboxamide (PubChem CID 141395777) has the molecular formula C20H33N3O and a molecular weight of 331.50 g/mol. Its IUPAC name is 1-(3-ethyl-1,2,3,5,6,6a-hexahydrocyclopenta[c]pyrrol-5-yl)-N-(1-methylcyclobutyl)piperidine-4-carboxamide.
| Compound Name | 1-(3-ethyl-1,2,3,5,6,6a-hexahydrocyclopenta[c]pyrrol-5-yl)-N-(1-methylcyclobutyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 141395777 |
| Molecular Formula | C20H33N3O |
| Molecular Weight | 331.50 g/mol |
| Exact Mass | 331.26 |
| IUPAC Name | 1-(3-ethyl-1,2,3,5,6,6a-hexahydrocyclopenta[c]pyrrol-5-yl)-N-(1-methylcyclobutyl)piperidine-4-carboxamide |
| SMILES | CCC1NCC2CC(N3CCC(C(=O)NC4(C)CCC4)CC3)C=C21 |
| InChI | InChI=1S/C20H33N3O/c1-3-18-17-12-16(11-15(17)13-21-18)23-9-5-14(6-10-23)19(24)22-20(2)7-4-8-20/h12,14-16,18,21H,3-11,13H2,1-2H3,(H,22,24) |
| InChIKey | KCTFSMUNGKEQPQ-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.50 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|