C20H32O5 — CID 14139612
methyl (2E,4E)-11-[3-(methoxymethyl)-4-oxooxetan-2-yl]-3,5,7-trimethylundeca-2,4-dienoate (PubChem CID 14139612) has the molecular formula C20H32O5 and a molecular weight of 352.47 g/mol. Its IUPAC name is methyl (2E,4E)-11-[3-(methoxymethyl)-4-oxooxetan-2-yl]-3,5,7-trimethylundeca-2,4-dienoate.
| Compound Name | methyl (2E,4E)-11-[3-(methoxymethyl)-4-oxooxetan-2-yl]-3,5,7-trimethylundeca-2,4-dienoate |
|---|---|
| PubChem CID | 14139612 |
| Molecular Formula | C20H32O5 |
| Molecular Weight | 352.47 g/mol |
| Exact Mass | 352.22 |
| IUPAC Name | methyl (2E,4E)-11-[3-(methoxymethyl)-4-oxooxetan-2-yl]-3,5,7-trimethylundeca-2,4-dienoate |
| SMILES | COCC1C(=O)OC1CCCCC(C)C/C(C)=C/C(C)=C/C(=O)OC |
| InChI | InChI=1S/C20H32O5/c1-14(10-15(2)11-16(3)12-19(21)24-5)8-6-7-9-18-17(13-23-4)20(22)25-18/h11-12,14,17-18H,6-10,13H2,1-5H3/b15-11+,16-12+ |
| InChIKey | KMOZXMOGJWOKJV-JOBJLJCHSA-N |
| XLogP | 3.83 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.47 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'four_member_lactones', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|