C14H22 — CID 141396778
5,6-di(propan-2-yl)-1,2,3,4-tetrahydropentalene (PubChem CID 141396778) has the molecular formula C14H22 and a molecular weight of 190.33 g/mol. Its IUPAC name is 5,6-di(propan-2-yl)-1,2,3,4-tetrahydropentalene.
| Compound Name | 5,6-di(propan-2-yl)-1,2,3,4-tetrahydropentalene |
|---|---|
| PubChem CID | 141396778 |
| Molecular Formula | C14H22 |
| Molecular Weight | 190.33 g/mol |
| Exact Mass | 190.17 |
| IUPAC Name | 5,6-di(propan-2-yl)-1,2,3,4-tetrahydropentalene |
| SMILES | CC(C)C1=C(C(C)C)C2=C(CCC2)C1 |
| InChI | InChI=1S/C14H22/c1-9(2)13-8-11-6-5-7-12(11)14(13)10(3)4/h9-10H,5-8H2,1-4H3 |
| InChIKey | DJZSJSZWDBRPGP-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.33 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |