C15H17NO5 — CID 141397653
3,4-dihydroxy-8-[(3S,4R)-3-hydroxy-1-methylpiperidin-4-yl]chromen-2-one (PubChem CID 141397653) has the molecular formula C15H17NO5 and a molecular weight of 291.30 g/mol. Its IUPAC name is 3,4-dihydroxy-8-[(3S,4R)-3-hydroxy-1-methylpiperidin-4-yl]chromen-2-one.
| Compound Name | 3,4-dihydroxy-8-[(3S,4R)-3-hydroxy-1-methylpiperidin-4-yl]chromen-2-one |
|---|---|
| PubChem CID | 141397653 |
| Molecular Formula | C15H17NO5 |
| Molecular Weight | 291.30 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | 3,4-dihydroxy-8-[(3S,4R)-3-hydroxy-1-methylpiperidin-4-yl]chromen-2-one |
| SMILES | CN1CC[C@H](c2cccc3c(O)c(O)c(=O)oc23)[C@H](O)C1 |
| InChI | InChI=1S/C15H17NO5/c1-16-6-5-8(11(17)7-16)9-3-2-4-10-12(18)13(19)15(20)21-14(9)10/h2-4,8,11,17-19H,5-7H2,1H3/t8-,11-/m1/s1 |
| InChIKey | HRIZDSIIPWNVNQ-LDYMZIIASA-N |
| XLogP | 0.98 |
| TPSA | 94.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.30 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|