C15H28O3 — CID 14139796
(6E)-2,6,10-trimethyldodeca-6,11-diene-2,3,10-triol (PubChem CID 14139796) has the molecular formula C15H28O3 and a molecular weight of 256.39 g/mol. Its IUPAC name is (6E)-2,6,10-trimethyldodeca-6,11-diene-2,3,10-triol.
| Compound Name | (6E)-2,6,10-trimethyldodeca-6,11-diene-2,3,10-triol |
|---|---|
| PubChem CID | 14139796 |
| Molecular Formula | C15H28O3 |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.20 |
| IUPAC Name | (6E)-2,6,10-trimethyldodeca-6,11-diene-2,3,10-triol |
| SMILES | C=CC(C)(O)CC/C=C(\C)CCC(O)C(C)(C)O |
| InChI | InChI=1S/C15H28O3/c1-6-15(5,18)11-7-8-12(2)9-10-13(16)14(3,4)17/h6,8,13,16-18H,1,7,9-11H2,2-5H3/b12-8+ |
| InChIKey | BGUYVWYUIXKRDO-XYOKQWHBSA-N |
| XLogP | 2.56 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|