C19H24O2Si — CID 14139850
(5Z)-9-[tert-butyl(dimethyl)silyl]oxybicyclo[7.3.1]trideca-1(12),5-dien-3,7-diyn-13-one (PubChem CID 14139850) has the molecular formula C19H24O2Si and a molecular weight of 312.49 g/mol. Its IUPAC name is (5Z)-9-[tert-butyl(dimethyl)silyl]oxybicyclo[7.3.1]trideca-1(12),5-dien-3,7-diyn-13-one.
| Compound Name | (5Z)-9-[tert-butyl(dimethyl)silyl]oxybicyclo[7.3.1]trideca-1(12),5-dien-3,7-diyn-13-one |
|---|---|
| PubChem CID | 14139850 |
| Molecular Formula | C19H24O2Si |
| Molecular Weight | 312.49 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | (5Z)-9-[tert-butyl(dimethyl)silyl]oxybicyclo[7.3.1]trideca-1(12),5-dien-3,7-diyn-13-one |
| SMILES | CC(C)(C)[Si](C)(C)OC12C#C/C=C\C#CCC(=CCC1)C2=O |
| InChI | InChI=1S/C19H24O2Si/c1-18(2,3)22(4,5)21-19-14-10-8-6-7-9-12-16(17(19)20)13-11-15-19/h6,8,13H,11-12,15H2,1-5H3/b8-6- |
| InChIKey | VNQJIBDWVUVYPF-VURMDHGXSA-N |
| XLogP | 4.00 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.49 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|