About (4-chloro-3-methyl-2-pyridinyl) N,N-dimethylcarbamate
(4-chloro-3-methyl-2-pyridinyl) N,N-dimethylcarbamate (PubChem CID 141398917) has the molecular formula C9H11ClN2O2
and a molecular weight of 214.65 g/mol. Its IUPAC name is (4-chloro-3-methyl-2-pyridinyl) N,N-dimethylcarbamate.
Molecular Properties
| Compound Name | (4-chloro-3-methyl-2-pyridinyl) N,N-dimethylcarbamate |
| PubChem CID | 141398917 |
| Molecular Formula | C9H11ClN2O2 |
| Molecular Weight | 214.65 g/mol |
| Exact Mass | 214.05 |
| IUPAC Name | (4-chloro-3-methyl-2-pyridinyl) N,N-dimethylcarbamate |
| SMILES | Cc1c(Cl)ccnc1OC(=O)N(C)C |
| InChI | InChI=1S/C9H11ClN2O2/c1-6-7(10)4-5-11-8(6)14-9(13)12(2)3/h4-5H,1-3H3 |
| InChIKey | SGFJRTVINMKTOV-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.65 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4-chloro-3-methyl-2-pyridinyl) N,N-dimethylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-chloro-3-methyl-2-pyridinyl) N,N-dimethylcarbamate?
The IUPAC name of (4-chloro-3-methyl-2-pyridinyl) N,N-dimethylcarbamate (CID 141398917) is (4-chloro-3-methyl-2-pyridinyl) N,N-dimethylcarbamate.
What is the SMILES notation for (4-chloro-3-methyl-2-pyridinyl) N,N-dimethylcarbamate?
The canonical SMILES for (4-chloro-3-methyl-2-pyridinyl) N,N-dimethylcarbamate is Cc1c(Cl)ccnc1OC(=O)N(C)C.
What is the InChIKey of (4-chloro-3-methyl-2-pyridinyl) N,N-dimethylcarbamate?
The InChIKey is SGFJRTVINMKTOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11ClN2O2/c1-6-7(10)4-5-11-8(6)14-9(13)12(2)3/h4-5H,1-3H3.
What are the key properties of (4-chloro-3-methyl-2-pyridinyl) N,N-dimethylcarbamate?
(4-chloro-3-methyl-2-pyridinyl) N,N-dimethylcarbamate has a molecular weight of 214.65 g/mol, XLogP of 2.10, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-chloro-3-methyl-2-pyridinyl) N,N-dimethylcarbamate is sourced from PubChem (CID 141398917), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).