C14H8FNOS — CID 141399174
13-fluoro-8-oxa-11-thia-3-azatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2(7),3,5,12(17),13,15-heptaene (PubChem CID 141399174) has the molecular formula C14H8FNOS and a molecular weight of 257.29 g/mol. Its IUPAC name is 13-fluoro-8-oxa-11-thia-3-azatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2(7),3,5,12(17),13,15-heptaene.
| Compound Name | 13-fluoro-8-oxa-11-thia-3-azatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2(7),3,5,12(17),13,15-heptaene |
|---|---|
| PubChem CID | 141399174 |
| Molecular Formula | C14H8FNOS |
| Molecular Weight | 257.29 g/mol |
| Exact Mass | 257.03 |
| IUPAC Name | 13-fluoro-8-oxa-11-thia-3-azatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2(7),3,5,12(17),13,15-heptaene |
| SMILES | Fc1cccc2c3c(sc12)COc1cccnc1-3 |
| InChI | InChI=1S/C14H8FNOS/c15-9-4-1-3-8-12-11(18-14(8)9)7-17-10-5-2-6-16-13(10)12/h1-6H,7H2 |
| InChIKey | BISCZRLXVASYHL-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.29 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |