C26H43NO2 — CID 141399986
tert-butyl N-[(3S,8R,9S,10S,13S,14S,17Z)-17-ethylidene-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-3-yl]carbamate (PubChem CID 141399986) has the molecular formula C26H43NO2 and a molecular weight of 401.64 g/mol. Its IUPAC name is tert-butyl N-[(3S,8R,9S,10S,13S,14S,17Z)-17-ethylidene-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3S,8R,9S,10S,13S,14S,17Z)-17-ethylidene-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-3-yl]carbamate |
|---|---|
| PubChem CID | 141399986 |
| Molecular Formula | C26H43NO2 |
| Molecular Weight | 401.64 g/mol |
| Exact Mass | 401.33 |
| IUPAC Name | tert-butyl N-[(3S,8R,9S,10S,13S,14S,17Z)-17-ethylidene-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-3-yl]carbamate |
| SMILES | C/C=C1/CC[C@H]2[C@@H]3CCC4C[C@@H](NC(=O)OC(C)(C)C)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C26H43NO2/c1-7-17-9-11-21-20-10-8-18-16-19(27-23(28)29-24(2,3)4)12-14-26(18,6)22(20)13-15-25(17,21)5/h7,18-22H,8-16H2,1-6H3,(H,27,28)/b17-7-/t18?,19-,20-,21-,22-,25+,26-/m0/s1 |
| InChIKey | BPLVEEFPAHOGSW-ZMDSPGRSSA-N |
| XLogP | 6.87 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.64 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|