About 4-bromo-2,6-dichlorobenzene-1,3-dicarboxylic acid
4-bromo-2,6-dichlorobenzene-1,3-dicarboxylic acid (PubChem CID 141400007) has the molecular formula C8H3BrCl2O4
and a molecular weight of 313.92 g/mol. Its IUPAC name is 4-bromo-2,6-dichlorobenzene-1,3-dicarboxylic acid.
Molecular Properties
| Compound Name | 4-bromo-2,6-dichlorobenzene-1,3-dicarboxylic acid |
| PubChem CID | 141400007 |
| Molecular Formula | C8H3BrCl2O4 |
| Molecular Weight | 313.92 g/mol |
| Exact Mass | 311.86 |
| IUPAC Name | 4-bromo-2,6-dichlorobenzene-1,3-dicarboxylic acid |
| SMILES | O=C(O)c1c(Cl)cc(Br)c(C(=O)O)c1Cl |
| InChI | InChI=1S/C8H3BrCl2O4/c9-2-1-3(10)5(8(14)15)6(11)4(2)7(12)13/h1H,(H,12,13)(H,14,15) |
| InChIKey | RNQQOXMHGSVIPA-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.92 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-bromo-2,6-dichlorobenzene-1,3-dicarboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-2,6-dichlorobenzene-1,3-dicarboxylic acid?
The IUPAC name of 4-bromo-2,6-dichlorobenzene-1,3-dicarboxylic acid (CID 141400007) is 4-bromo-2,6-dichlorobenzene-1,3-dicarboxylic acid.
What is the SMILES notation for 4-bromo-2,6-dichlorobenzene-1,3-dicarboxylic acid?
The canonical SMILES for 4-bromo-2,6-dichlorobenzene-1,3-dicarboxylic acid is O=C(O)c1c(Cl)cc(Br)c(C(=O)O)c1Cl.
What is the InChIKey of 4-bromo-2,6-dichlorobenzene-1,3-dicarboxylic acid?
The InChIKey is RNQQOXMHGSVIPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H3BrCl2O4/c9-2-1-3(10)5(8(14)15)6(11)4(2)7(12)13/h1H,(H,12,13)(H,14,15).
What are the key properties of 4-bromo-2,6-dichlorobenzene-1,3-dicarboxylic acid?
4-bromo-2,6-dichlorobenzene-1,3-dicarboxylic acid has a molecular weight of 313.92 g/mol, XLogP of 3.15, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-2,6-dichlorobenzene-1,3-dicarboxylic acid is sourced from PubChem (CID 141400007), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).