About 3-amino-2,4-dioxo-1H-pyrimidine-5-carboxamide
3-amino-2,4-dioxo-1H-pyrimidine-5-carboxamide (PubChem CID 141400473) has the molecular formula C5H6N4O3
and a molecular weight of 170.13 g/mol. Its IUPAC name is 3-amino-2,4-dioxo-1H-pyrimidine-5-carboxamide.
Molecular Properties
| Compound Name | 3-amino-2,4-dioxo-1H-pyrimidine-5-carboxamide |
| PubChem CID | 141400473 |
| Molecular Formula | C5H6N4O3 |
| Molecular Weight | 170.13 g/mol |
| Exact Mass | 170.04 |
| IUPAC Name | 3-amino-2,4-dioxo-1H-pyrimidine-5-carboxamide |
| SMILES | NC(=O)c1c[nH]c(=O)n(N)c1=O |
| InChI | InChI=1S/C5H6N4O3/c6-3(10)2-1-8-5(12)9(7)4(2)11/h1H,7H2,(H2,6,10)(H,8,12) |
| InChIKey | TVTZLOIJNCNFEI-UHFFFAOYSA-N |
| XLogP | -2.65 |
| TPSA | 123.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.13 |
| LogP ≤ 5 | -2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-amino-2,4-dioxo-1H-pyrimidine-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-2,4-dioxo-1H-pyrimidine-5-carboxamide?
The IUPAC name of 3-amino-2,4-dioxo-1H-pyrimidine-5-carboxamide (CID 141400473) is 3-amino-2,4-dioxo-1H-pyrimidine-5-carboxamide.
What is the SMILES notation for 3-amino-2,4-dioxo-1H-pyrimidine-5-carboxamide?
The canonical SMILES for 3-amino-2,4-dioxo-1H-pyrimidine-5-carboxamide is NC(=O)c1c[nH]c(=O)n(N)c1=O.
What is the InChIKey of 3-amino-2,4-dioxo-1H-pyrimidine-5-carboxamide?
The InChIKey is TVTZLOIJNCNFEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6N4O3/c6-3(10)2-1-8-5(12)9(7)4(2)11/h1H,7H2,(H2,6,10)(H,8,12).
What are the key properties of 3-amino-2,4-dioxo-1H-pyrimidine-5-carboxamide?
3-amino-2,4-dioxo-1H-pyrimidine-5-carboxamide has a molecular weight of 170.13 g/mol, XLogP of -2.65, 1 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-2,4-dioxo-1H-pyrimidine-5-carboxamide is sourced from PubChem (CID 141400473), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).