C19H14FN5O2 — CID 141400501
4-[[1-[(3-fluorophenyl)methyl]indazol-5-yl]amino]pyrimidine-5-carboxylic acid (PubChem CID 141400501) has the molecular formula C19H14FN5O2 and a molecular weight of 363.35 g/mol. Its IUPAC name is 4-[[1-[(3-fluorophenyl)methyl]indazol-5-yl]amino]pyrimidine-5-carboxylic acid.
| Compound Name | 4-[[1-[(3-fluorophenyl)methyl]indazol-5-yl]amino]pyrimidine-5-carboxylic acid |
|---|---|
| PubChem CID | 141400501 |
| Molecular Formula | C19H14FN5O2 |
| Molecular Weight | 363.35 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | 4-[[1-[(3-fluorophenyl)methyl]indazol-5-yl]amino]pyrimidine-5-carboxylic acid |
| SMILES | O=C(O)c1cncnc1Nc1ccc2c(cnn2Cc2cccc(F)c2)c1 |
| InChI | InChI=1S/C19H14FN5O2/c20-14-3-1-2-12(6-14)10-25-17-5-4-15(7-13(17)8-23-25)24-18-16(19(26)27)9-21-11-22-18/h1-9,11H,10H2,(H,26,27)(H,21,22,24) |
| InChIKey | FTXTXXCARZQBED-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.35 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |