C25H18FN5O — CID 141400526
4-[[1-[(3-fluorophenyl)methyl]indazol-5-yl]amino]-6-methoxyquinoline-3-carbonitrile (PubChem CID 141400526) has the molecular formula C25H18FN5O and a molecular weight of 423.45 g/mol. Its IUPAC name is 4-[[1-[(3-fluorophenyl)methyl]indazol-5-yl]amino]-6-methoxyquinoline-3-carbonitrile.
| Compound Name | 4-[[1-[(3-fluorophenyl)methyl]indazol-5-yl]amino]-6-methoxyquinoline-3-carbonitrile |
|---|---|
| PubChem CID | 141400526 |
| Molecular Formula | C25H18FN5O |
| Molecular Weight | 423.45 g/mol |
| Exact Mass | 423.15 |
| IUPAC Name | 4-[[1-[(3-fluorophenyl)methyl]indazol-5-yl]amino]-6-methoxyquinoline-3-carbonitrile |
| SMILES | COc1ccc2ncc(C#N)c(Nc3ccc4c(cnn4Cc4cccc(F)c4)c3)c2c1 |
| InChI | InChI=1S/C25H18FN5O/c1-32-21-6-7-23-22(11-21)25(18(12-27)13-28-23)30-20-5-8-24-17(10-20)14-29-31(24)15-16-3-2-4-19(26)9-16/h2-11,13-14H,15H2,1H3,(H,28,30) |
| InChIKey | HCPXRRDYIKDIGX-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 75.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.45 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |