About (5S,7S)-7-methyl-6,7-dihydro-5H-cyclopenta[c]pyridin-5-ol
(5S,7S)-7-methyl-6,7-dihydro-5H-cyclopenta[c]pyridin-5-ol (PubChem CID 14140053) has the molecular formula C9H11NO
and a molecular weight of 149.19 g/mol. Its IUPAC name is (5S,7S)-7-methyl-6,7-dihydro-5H-cyclopenta[c]pyridin-5-ol.
Molecular Properties
| Compound Name | (5S,7S)-7-methyl-6,7-dihydro-5H-cyclopenta[c]pyridin-5-ol |
| PubChem CID | 14140053 |
| Molecular Formula | C9H11NO |
| Molecular Weight | 149.19 g/mol |
| Exact Mass | 149.08 |
| IUPAC Name | (5S,7S)-7-methyl-6,7-dihydro-5H-cyclopenta[c]pyridin-5-ol |
| SMILES | C[C@H]1C[C@H](O)c2ccncc21 |
| InChI | InChI=1S/C9H11NO/c1-6-4-9(11)7-2-3-10-5-8(6)7/h2-3,5-6,9,11H,4H2,1H3/t6-,9-/m0/s1 |
| InChIKey | PAULFLQQVQANMT-RCOVLWMOSA-N |
| XLogP | 1.62 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.19 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (5S,7S)-7-methyl-6,7-dihydro-5H-cyclopenta[c]pyridin-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5S,7S)-7-methyl-6,7-dihydro-5H-cyclopenta[c]pyridin-5-ol?
The IUPAC name of (5S,7S)-7-methyl-6,7-dihydro-5H-cyclopenta[c]pyridin-5-ol (CID 14140053) is (5S,7S)-7-methyl-6,7-dihydro-5H-cyclopenta[c]pyridin-5-ol.
What is the SMILES notation for (5S,7S)-7-methyl-6,7-dihydro-5H-cyclopenta[c]pyridin-5-ol?
The canonical SMILES for (5S,7S)-7-methyl-6,7-dihydro-5H-cyclopenta[c]pyridin-5-ol is C[C@H]1C[C@H](O)c2ccncc21.
What is the InChIKey of (5S,7S)-7-methyl-6,7-dihydro-5H-cyclopenta[c]pyridin-5-ol?
The InChIKey is PAULFLQQVQANMT-RCOVLWMOSA-N. The full InChI is InChI=1S/C9H11NO/c1-6-4-9(11)7-2-3-10-5-8(6)7/h2-3,5-6,9,11H,4H2,1H3/t6-,9-/m0/s1.
What are the key properties of (5S,7S)-7-methyl-6,7-dihydro-5H-cyclopenta[c]pyridin-5-ol?
(5S,7S)-7-methyl-6,7-dihydro-5H-cyclopenta[c]pyridin-5-ol has a molecular weight of 149.19 g/mol, XLogP of 1.62, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5S,7S)-7-methyl-6,7-dihydro-5H-cyclopenta[c]pyridin-5-ol is sourced from PubChem (CID 14140053), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).