C15H14N6OS2 — CID 141400723
2-N-(furan-2-ylamino)-2-N-(1H-pyrrol-2-ylamino)-4-N-thiophen-2-yl-1,3-thiazole-2,4-diamine (PubChem CID 141400723) has the molecular formula C15H14N6OS2 and a molecular weight of 358.45 g/mol. Its IUPAC name is 2-N-(furan-2-ylamino)-2-N-(1H-pyrrol-2-ylamino)-4-N-thiophen-2-yl-1,3-thiazole-2,4-diamine.
| Compound Name | 2-N-(furan-2-ylamino)-2-N-(1H-pyrrol-2-ylamino)-4-N-thiophen-2-yl-1,3-thiazole-2,4-diamine |
|---|---|
| PubChem CID | 141400723 |
| Molecular Formula | C15H14N6OS2 |
| Molecular Weight | 358.45 g/mol |
| Exact Mass | 358.07 |
| IUPAC Name | 2-N-(furan-2-ylamino)-2-N-(1H-pyrrol-2-ylamino)-4-N-thiophen-2-yl-1,3-thiazole-2,4-diamine |
| SMILES | c1c[nH]c(NN(Nc2ccco2)c2nc(Nc3cccs3)cs2)c1 |
| InChI | InChI=1S/C15H14N6OS2/c1-4-11(16-7-1)19-21(20-13-5-2-8-22-13)15-18-12(10-24-15)17-14-6-3-9-23-14/h1-10,16-17,19-20H |
| InChIKey | ARCOMNXYUUPEMU-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 81.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.45 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|