C16H42N2Si4 — CID 141400961
1-N,1-N,1-N',1-N'-tetrakis(trimethylsilyl)but-3-ene-1,1-diamine (PubChem CID 141400961) has the molecular formula C16H42N2Si4 and a molecular weight of 374.87 g/mol. Its IUPAC name is 1-N,1-N,1-N',1-N'-tetrakis(trimethylsilyl)but-3-ene-1,1-diamine.
| Compound Name | 1-N,1-N,1-N',1-N'-tetrakis(trimethylsilyl)but-3-ene-1,1-diamine |
|---|---|
| PubChem CID | 141400961 |
| Molecular Formula | C16H42N2Si4 |
| Molecular Weight | 374.87 g/mol |
| Exact Mass | 374.24 |
| IUPAC Name | 1-N,1-N,1-N',1-N'-tetrakis(trimethylsilyl)but-3-ene-1,1-diamine |
| SMILES | C=CCC(N([Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C16H42N2Si4/c1-14-15-16(17(19(2,3)4)20(5,6)7)18(21(8,9)10)22(11,12)13/h14,16H,1,15H2,2-13H3 |
| InChIKey | FKZOYXLCUOUVMF-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.87 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|