C27H36F3NO — CID 141401078
1-[(1R)-1-[7-(4-ethylcyclohexyl)oxy-8-(trifluoromethyl)naphthalen-2-yl]propyl]piperidine (PubChem CID 141401078) has the molecular formula C27H36F3NO and a molecular weight of 447.59 g/mol. Its IUPAC name is 1-[(1R)-1-[7-(4-ethylcyclohexyl)oxy-8-(trifluoromethyl)naphthalen-2-yl]propyl]piperidine.
| Compound Name | 1-[(1R)-1-[7-(4-ethylcyclohexyl)oxy-8-(trifluoromethyl)naphthalen-2-yl]propyl]piperidine |
|---|---|
| PubChem CID | 141401078 |
| Molecular Formula | C27H36F3NO |
| Molecular Weight | 447.59 g/mol |
| Exact Mass | 447.27 |
| IUPAC Name | 1-[(1R)-1-[7-(4-ethylcyclohexyl)oxy-8-(trifluoromethyl)naphthalen-2-yl]propyl]piperidine |
| SMILES | CCC1CCC(Oc2ccc3ccc([C@@H](CC)N4CCCCC4)cc3c2C(F)(F)F)CC1 |
| InChI | InChI=1S/C27H36F3NO/c1-3-19-8-13-22(14-9-19)32-25-15-12-20-10-11-21(18-23(20)26(25)27(28,29)30)24(4-2)31-16-6-5-7-17-31/h10-12,15,18-19,22,24H,3-9,13-14,16-17H2,1-2H3/t19?,22?,24-/m1/s1 |
| InChIKey | SXFQYTIDTZHVNK-MXJXRJBTSA-N |
| XLogP | 8.14 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.59 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |