C11H18 — CID 141401221
(2S,4aR)-2-methyl-1,2,3,4,4a,5,6,7-octahydronaphthalene (PubChem CID 141401221) has the molecular formula C11H18 and a molecular weight of 150.26 g/mol. Its IUPAC name is (2S,4aR)-2-methyl-1,2,3,4,4a,5,6,7-octahydronaphthalene.
| Compound Name | (2S,4aR)-2-methyl-1,2,3,4,4a,5,6,7-octahydronaphthalene |
|---|---|
| PubChem CID | 141401221 |
| Molecular Formula | C11H18 |
| Molecular Weight | 150.26 g/mol |
| Exact Mass | 150.14 |
| IUPAC Name | (2S,4aR)-2-methyl-1,2,3,4,4a,5,6,7-octahydronaphthalene |
| SMILES | C[C@H]1CC[C@H]2CCCC=C2C1 |
| InChI | InChI=1S/C11H18/c1-9-6-7-10-4-2-3-5-11(10)8-9/h5,9-10H,2-4,6-8H2,1H3/t9-,10+/m0/s1 |
| InChIKey | FTHQVRZLMKGORD-VHSXEESVSA-N |
| XLogP | 3.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.26 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|