C40H34O6 — CID 141401303
(2,3-dimethylphenyl) 6-[1-[6-(2,3-dimethylphenoxy)carbonylnaphthalen-2-yl]oxyethoxy]naphthalene-2-carboxylate (PubChem CID 141401303) has the molecular formula C40H34O6 and a molecular weight of 610.71 g/mol. Its IUPAC name is (2,3-dimethylphenyl) 6-[1-[6-(2,3-dimethylphenoxy)carbonylnaphthalen-2-yl]oxyethoxy]naphthalene-2-carboxylate.
| Compound Name | (2,3-dimethylphenyl) 6-[1-[6-(2,3-dimethylphenoxy)carbonylnaphthalen-2-yl]oxyethoxy]naphthalene-2-carboxylate |
|---|---|
| PubChem CID | 141401303 |
| Molecular Formula | C40H34O6 |
| Molecular Weight | 610.71 g/mol |
| Exact Mass | 610.24 |
| IUPAC Name | (2,3-dimethylphenyl) 6-[1-[6-(2,3-dimethylphenoxy)carbonylnaphthalen-2-yl]oxyethoxy]naphthalene-2-carboxylate |
| SMILES | Cc1cccc(OC(=O)c2ccc3cc(OC(C)Oc4ccc5cc(C(=O)Oc6cccc(C)c6C)ccc5c4)ccc3c2)c1C |
| InChI | InChI=1S/C40H34O6/c1-24-8-6-10-37(26(24)3)45-39(41)33-14-12-31-22-35(18-16-29(31)20-33)43-28(5)44-36-19-17-30-21-34(15-13-32(30)23-36)40(42)46-38-11-7-9-25(2)27(38)4/h6-23,28H,1-5H3 |
| InChIKey | LRUCYHKDDXUABS-UHFFFAOYSA-N |
| XLogP | 9.47 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.71 |
| LogP ≤ 5 | 9.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|