C13H24N2OSi — CID 141401661
trimethyl-[2-(4,5,6,7-tetrahydroindazol-1-ylmethoxy)ethyl]silane (PubChem CID 141401661) has the molecular formula C13H24N2OSi and a molecular weight of 252.43 g/mol. Its IUPAC name is trimethyl-[2-(4,5,6,7-tetrahydroindazol-1-ylmethoxy)ethyl]silane.
| Compound Name | trimethyl-[2-(4,5,6,7-tetrahydroindazol-1-ylmethoxy)ethyl]silane |
|---|---|
| PubChem CID | 141401661 |
| Molecular Formula | C13H24N2OSi |
| Molecular Weight | 252.43 g/mol |
| Exact Mass | 252.17 |
| IUPAC Name | trimethyl-[2-(4,5,6,7-tetrahydroindazol-1-ylmethoxy)ethyl]silane |
| SMILES | C[Si](C)(C)CCOCn1ncc2c1CCCC2 |
| InChI | InChI=1S/C13H24N2OSi/c1-17(2,3)9-8-16-11-15-13-7-5-4-6-12(13)10-14-15/h10H,4-9,11H2,1-3H3 |
| InChIKey | LSNQGGCFUBTGFO-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.43 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|