About butylazanium;4-(trifluoromethyl)benzenesulfinate
butylazanium;4-(trifluoromethyl)benzenesulfinate (PubChem CID 141401723) has the molecular formula C11H16F3NO2S
and a molecular weight of 283.31 g/mol. Its IUPAC name is butylazanium;4-(trifluoromethyl)benzenesulfinate.
Molecular Properties
| Compound Name | butylazanium;4-(trifluoromethyl)benzenesulfinate |
| PubChem CID | 141401723 |
| Molecular Formula | C11H16F3NO2S |
| Molecular Weight | 283.31 g/mol |
| Exact Mass | 283.09 |
| IUPAC Name | butylazanium;4-(trifluoromethyl)benzenesulfinate |
| SMILES | CCCC[NH3+].O=S([O-])c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C7H5F3O2S.C4H11N/c8-7(9,10)5-1-3-6(4-2-5)13(11)12;1-2-3-4-5/h1-4H,(H,11,12);2-5H2,1H3 |
| InChIKey | MADZSKJUPDMYOW-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.31 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze butylazanium;4-(trifluoromethyl)benzenesulfinate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butylazanium;4-(trifluoromethyl)benzenesulfinate?
The IUPAC name of butylazanium;4-(trifluoromethyl)benzenesulfinate (CID 141401723) is butylazanium;4-(trifluoromethyl)benzenesulfinate.
What is the SMILES notation for butylazanium;4-(trifluoromethyl)benzenesulfinate?
The canonical SMILES for butylazanium;4-(trifluoromethyl)benzenesulfinate is CCCC[NH3+].O=S([O-])c1ccc(C(F)(F)F)cc1.
What is the InChIKey of butylazanium;4-(trifluoromethyl)benzenesulfinate?
The InChIKey is MADZSKJUPDMYOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5F3O2S.C4H11N/c8-7(9,10)5-1-3-6(4-2-5)13(11)12;1-2-3-4-5/h1-4H,(H,11,12);2-5H2,1H3.
What are the key properties of butylazanium;4-(trifluoromethyl)benzenesulfinate?
butylazanium;4-(trifluoromethyl)benzenesulfinate has a molecular weight of 283.31 g/mol, XLogP of 1.97, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for butylazanium;4-(trifluoromethyl)benzenesulfinate is sourced from PubChem (CID 141401723), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).