About 2-triethoxysilylhexanoic acid
2-triethoxysilylhexanoic acid (PubChem CID 141402129) has the molecular formula C12H26O5Si
and a molecular weight of 278.42 g/mol. Its IUPAC name is 2-triethoxysilylhexanoic acid.
Molecular Properties
| Compound Name | 2-triethoxysilylhexanoic acid |
| PubChem CID | 141402129 |
| Molecular Formula | C12H26O5Si |
| Molecular Weight | 278.42 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | 2-triethoxysilylhexanoic acid |
| SMILES | CCCCC(C(=O)O)[Si](OCC)(OCC)OCC |
| InChI | InChI=1S/C12H26O5Si/c1-5-9-10-11(12(13)14)18(15-6-2,16-7-3)17-8-4/h11H,5-10H2,1-4H3,(H,13,14) |
| InChIKey | ZBFSAQPBFDHBNR-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.42 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-triethoxysilylhexanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-triethoxysilylhexanoic acid?
The IUPAC name of 2-triethoxysilylhexanoic acid (CID 141402129) is 2-triethoxysilylhexanoic acid.
What is the SMILES notation for 2-triethoxysilylhexanoic acid?
The canonical SMILES for 2-triethoxysilylhexanoic acid is CCCCC(C(=O)O)[Si](OCC)(OCC)OCC.
What is the InChIKey of 2-triethoxysilylhexanoic acid?
The InChIKey is ZBFSAQPBFDHBNR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H26O5Si/c1-5-9-10-11(12(13)14)18(15-6-2,16-7-3)17-8-4/h11H,5-10H2,1-4H3,(H,13,14).
What are the key properties of 2-triethoxysilylhexanoic acid?
2-triethoxysilylhexanoic acid has a molecular weight of 278.42 g/mol, XLogP of 2.68, 11 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-triethoxysilylhexanoic acid is sourced from PubChem (CID 141402129), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).