About 4-chloro-2-methyl-11H-[1,4]diazepino[2,3-b]quinoline
4-chloro-2-methyl-11H-[1,4]diazepino[2,3-b]quinoline (PubChem CID 141402166) has the molecular formula C13H10ClN3
and a molecular weight of 243.70 g/mol. Its IUPAC name is 4-chloro-2-methyl-11H-[1,4]diazepino[2,3-b]quinoline.
Molecular Properties
| Compound Name | 4-chloro-2-methyl-11H-[1,4]diazepino[2,3-b]quinoline |
| PubChem CID | 141402166 |
| Molecular Formula | C13H10ClN3 |
| Molecular Weight | 243.70 g/mol |
| Exact Mass | 243.06 |
| IUPAC Name | 4-chloro-2-methyl-11H-[1,4]diazepino[2,3-b]quinoline |
| SMILES | CC1=CC(Cl)=NC2=Nc3ccccc3CC2=N1 |
| InChI | InChI=1S/C13H10ClN3/c1-8-6-12(14)17-13-11(15-8)7-9-4-2-3-5-10(9)16-13/h2-6H,7H2,1H3 |
| InChIKey | OMOLSRYYJJSQTG-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 37.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.70 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-chloro-2-methyl-11H-[1,4]diazepino[2,3-b]quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-2-methyl-11H-[1,4]diazepino[2,3-b]quinoline?
The IUPAC name of 4-chloro-2-methyl-11H-[1,4]diazepino[2,3-b]quinoline (CID 141402166) is 4-chloro-2-methyl-11H-[1,4]diazepino[2,3-b]quinoline.
What is the SMILES notation for 4-chloro-2-methyl-11H-[1,4]diazepino[2,3-b]quinoline?
The canonical SMILES for 4-chloro-2-methyl-11H-[1,4]diazepino[2,3-b]quinoline is CC1=CC(Cl)=NC2=Nc3ccccc3CC2=N1.
What is the InChIKey of 4-chloro-2-methyl-11H-[1,4]diazepino[2,3-b]quinoline?
The InChIKey is OMOLSRYYJJSQTG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10ClN3/c1-8-6-12(14)17-13-11(15-8)7-9-4-2-3-5-10(9)16-13/h2-6H,7H2,1H3.
What are the key properties of 4-chloro-2-methyl-11H-[1,4]diazepino[2,3-b]quinoline?
4-chloro-2-methyl-11H-[1,4]diazepino[2,3-b]quinoline has a molecular weight of 243.70 g/mol, XLogP of 3.27, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-2-methyl-11H-[1,4]diazepino[2,3-b]quinoline is sourced from PubChem (CID 141402166), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).