C9H8F7I — CID 141402261
1,3,4,4,5,6,6-heptafluoro-5-iodo-3-propan-2-ylcyclohexene (PubChem CID 141402261) has the molecular formula C9H8F7I and a molecular weight of 376.05 g/mol. Its IUPAC name is 1,3,4,4,5,6,6-heptafluoro-5-iodo-3-propan-2-ylcyclohexene.
| Compound Name | 1,3,4,4,5,6,6-heptafluoro-5-iodo-3-propan-2-ylcyclohexene |
|---|---|
| PubChem CID | 141402261 |
| Molecular Formula | C9H8F7I |
| Molecular Weight | 376.05 g/mol |
| Exact Mass | 375.96 |
| IUPAC Name | 1,3,4,4,5,6,6-heptafluoro-5-iodo-3-propan-2-ylcyclohexene |
| SMILES | CC(C)C1(F)C=C(F)C(F)(F)C(F)(I)C1(F)F |
| InChI | InChI=1S/C9H8F7I/c1-4(2)6(11)3-5(10)7(12,13)9(16,17)8(6,14)15/h3-4H,1-2H3 |
| InChIKey | WPLNWLWDDSSLDH-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.05 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|