About butyl 6-butanoyl-6-hydroxy-5-methylcyclohexa-2,4-diene-1-carboxylate
butyl 6-butanoyl-6-hydroxy-5-methylcyclohexa-2,4-diene-1-carboxylate (PubChem CID 141402390) has the molecular formula C16H24O4
and a molecular weight of 280.36 g/mol. Its IUPAC name is butyl 6-butanoyl-6-hydroxy-5-methylcyclohexa-2,4-diene-1-carboxylate.
Molecular Properties
| Compound Name | butyl 6-butanoyl-6-hydroxy-5-methylcyclohexa-2,4-diene-1-carboxylate |
| PubChem CID | 141402390 |
| Molecular Formula | C16H24O4 |
| Molecular Weight | 280.36 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | butyl 6-butanoyl-6-hydroxy-5-methylcyclohexa-2,4-diene-1-carboxylate |
| SMILES | CCCCOC(=O)C1C=CC=C(C)C1(O)C(=O)CCC |
| InChI | InChI=1S/C16H24O4/c1-4-6-11-20-15(18)13-10-7-9-12(3)16(13,19)14(17)8-5-2/h7,9-10,13,19H,4-6,8,11H2,1-3H3 |
| InChIKey | GLDBTARWVIVJSA-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.36 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze butyl 6-butanoyl-6-hydroxy-5-methylcyclohexa-2,4-diene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl 6-butanoyl-6-hydroxy-5-methylcyclohexa-2,4-diene-1-carboxylate?
The IUPAC name of butyl 6-butanoyl-6-hydroxy-5-methylcyclohexa-2,4-diene-1-carboxylate (CID 141402390) is butyl 6-butanoyl-6-hydroxy-5-methylcyclohexa-2,4-diene-1-carboxylate.
What is the SMILES notation for butyl 6-butanoyl-6-hydroxy-5-methylcyclohexa-2,4-diene-1-carboxylate?
The canonical SMILES for butyl 6-butanoyl-6-hydroxy-5-methylcyclohexa-2,4-diene-1-carboxylate is CCCCOC(=O)C1C=CC=C(C)C1(O)C(=O)CCC.
What is the InChIKey of butyl 6-butanoyl-6-hydroxy-5-methylcyclohexa-2,4-diene-1-carboxylate?
The InChIKey is GLDBTARWVIVJSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24O4/c1-4-6-11-20-15(18)13-10-7-9-12(3)16(13,19)14(17)8-5-2/h7,9-10,13,19H,4-6,8,11H2,1-3H3.
What are the key properties of butyl 6-butanoyl-6-hydroxy-5-methylcyclohexa-2,4-diene-1-carboxylate?
butyl 6-butanoyl-6-hydroxy-5-methylcyclohexa-2,4-diene-1-carboxylate has a molecular weight of 280.36 g/mol, XLogP of 2.56, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for butyl 6-butanoyl-6-hydroxy-5-methylcyclohexa-2,4-diene-1-carboxylate is sourced from PubChem (CID 141402390), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).