About butyl 6-(2,2-dimethylpropanoyl)-6-propan-2-yloxycyclohexa-2,4-diene-1-carboxylate
butyl 6-(2,2-dimethylpropanoyl)-6-propan-2-yloxycyclohexa-2,4-diene-1-carboxylate (PubChem CID 141402394) has the molecular formula C19H30O4
and a molecular weight of 322.45 g/mol. Its IUPAC name is butyl 6-(2,2-dimethylpropanoyl)-6-propan-2-yloxycyclohexa-2,4-diene-1-carboxylate.
Molecular Properties
| Compound Name | butyl 6-(2,2-dimethylpropanoyl)-6-propan-2-yloxycyclohexa-2,4-diene-1-carboxylate |
| PubChem CID | 141402394 |
| Molecular Formula | C19H30O4 |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.21 |
| IUPAC Name | butyl 6-(2,2-dimethylpropanoyl)-6-propan-2-yloxycyclohexa-2,4-diene-1-carboxylate |
| SMILES | CCCCOC(=O)C1C=CC=CC1(OC(C)C)C(=O)C(C)(C)C |
| InChI | InChI=1S/C19H30O4/c1-7-8-13-22-16(20)15-11-9-10-12-19(15,23-14(2)3)17(21)18(4,5)6/h9-12,14-15H,7-8,13H2,1-6H3 |
| InChIKey | RJTACZDFMGEEJL-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze butyl 6-(2,2-dimethylpropanoyl)-6-propan-2-yloxycyclohexa-2,4-diene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl 6-(2,2-dimethylpropanoyl)-6-propan-2-yloxycyclohexa-2,4-diene-1-carboxylate?
The IUPAC name of butyl 6-(2,2-dimethylpropanoyl)-6-propan-2-yloxycyclohexa-2,4-diene-1-carboxylate (CID 141402394) is butyl 6-(2,2-dimethylpropanoyl)-6-propan-2-yloxycyclohexa-2,4-diene-1-carboxylate.
What is the SMILES notation for butyl 6-(2,2-dimethylpropanoyl)-6-propan-2-yloxycyclohexa-2,4-diene-1-carboxylate?
The canonical SMILES for butyl 6-(2,2-dimethylpropanoyl)-6-propan-2-yloxycyclohexa-2,4-diene-1-carboxylate is CCCCOC(=O)C1C=CC=CC1(OC(C)C)C(=O)C(C)(C)C.
What is the InChIKey of butyl 6-(2,2-dimethylpropanoyl)-6-propan-2-yloxycyclohexa-2,4-diene-1-carboxylate?
The InChIKey is RJTACZDFMGEEJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H30O4/c1-7-8-13-22-16(20)15-11-9-10-12-19(15,23-14(2)3)17(21)18(4,5)6/h9-12,14-15H,7-8,13H2,1-6H3.
What are the key properties of butyl 6-(2,2-dimethylpropanoyl)-6-propan-2-yloxycyclohexa-2,4-diene-1-carboxylate?
butyl 6-(2,2-dimethylpropanoyl)-6-propan-2-yloxycyclohexa-2,4-diene-1-carboxylate has a molecular weight of 322.45 g/mol, XLogP of 3.85, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for butyl 6-(2,2-dimethylpropanoyl)-6-propan-2-yloxycyclohexa-2,4-diene-1-carboxylate is sourced from PubChem (CID 141402394), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).