About 2-methylbutan-2-yl 6-hydroxy-5-methyl-6-propanoylcyclohexa-2,4-diene-1-carboxylate
2-methylbutan-2-yl 6-hydroxy-5-methyl-6-propanoylcyclohexa-2,4-diene-1-carboxylate (PubChem CID 141402399) has the molecular formula C16H24O4
and a molecular weight of 280.36 g/mol. Its IUPAC name is 2-methylbutan-2-yl 6-hydroxy-5-methyl-6-propanoylcyclohexa-2,4-diene-1-carboxylate.
Molecular Properties
| Compound Name | 2-methylbutan-2-yl 6-hydroxy-5-methyl-6-propanoylcyclohexa-2,4-diene-1-carboxylate |
| PubChem CID | 141402399 |
| Molecular Formula | C16H24O4 |
| Molecular Weight | 280.36 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | 2-methylbutan-2-yl 6-hydroxy-5-methyl-6-propanoylcyclohexa-2,4-diene-1-carboxylate |
| SMILES | CCC(=O)C1(O)C(C)=CC=CC1C(=O)OC(C)(C)CC |
| InChI | InChI=1S/C16H24O4/c1-6-13(17)16(19)11(3)9-8-10-12(16)14(18)20-15(4,5)7-2/h8-10,12,19H,6-7H2,1-5H3 |
| InChIKey | SEKBBDLJBJERIK-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.36 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-methylbutan-2-yl 6-hydroxy-5-methyl-6-propanoylcyclohexa-2,4-diene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylbutan-2-yl 6-hydroxy-5-methyl-6-propanoylcyclohexa-2,4-diene-1-carboxylate?
The IUPAC name of 2-methylbutan-2-yl 6-hydroxy-5-methyl-6-propanoylcyclohexa-2,4-diene-1-carboxylate (CID 141402399) is 2-methylbutan-2-yl 6-hydroxy-5-methyl-6-propanoylcyclohexa-2,4-diene-1-carboxylate.
What is the SMILES notation for 2-methylbutan-2-yl 6-hydroxy-5-methyl-6-propanoylcyclohexa-2,4-diene-1-carboxylate?
The canonical SMILES for 2-methylbutan-2-yl 6-hydroxy-5-methyl-6-propanoylcyclohexa-2,4-diene-1-carboxylate is CCC(=O)C1(O)C(C)=CC=CC1C(=O)OC(C)(C)CC.
What is the InChIKey of 2-methylbutan-2-yl 6-hydroxy-5-methyl-6-propanoylcyclohexa-2,4-diene-1-carboxylate?
The InChIKey is SEKBBDLJBJERIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24O4/c1-6-13(17)16(19)11(3)9-8-10-12(16)14(18)20-15(4,5)7-2/h8-10,12,19H,6-7H2,1-5H3.
What are the key properties of 2-methylbutan-2-yl 6-hydroxy-5-methyl-6-propanoylcyclohexa-2,4-diene-1-carboxylate?
2-methylbutan-2-yl 6-hydroxy-5-methyl-6-propanoylcyclohexa-2,4-diene-1-carboxylate has a molecular weight of 280.36 g/mol, XLogP of 2.56, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylbutan-2-yl 6-hydroxy-5-methyl-6-propanoylcyclohexa-2,4-diene-1-carboxylate is sourced from PubChem (CID 141402399), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).