C16H23N5S — CID 141402801
4-propyl-6-[3-(thiophen-2-ylmethylamino)pyrrolidin-1-yl]pyrimidin-2-amine (PubChem CID 141402801) has the molecular formula C16H23N5S and a molecular weight of 317.46 g/mol. Its IUPAC name is 4-propyl-6-[3-(thiophen-2-ylmethylamino)pyrrolidin-1-yl]pyrimidin-2-amine.
| Compound Name | 4-propyl-6-[3-(thiophen-2-ylmethylamino)pyrrolidin-1-yl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 141402801 |
| Molecular Formula | C16H23N5S |
| Molecular Weight | 317.46 g/mol |
| Exact Mass | 317.17 |
| IUPAC Name | 4-propyl-6-[3-(thiophen-2-ylmethylamino)pyrrolidin-1-yl]pyrimidin-2-amine |
| SMILES | CCCc1cc(N2CCC(NCc3cccs3)C2)nc(N)n1 |
| InChI | InChI=1S/C16H23N5S/c1-2-4-12-9-15(20-16(17)19-12)21-7-6-13(11-21)18-10-14-5-3-8-22-14/h3,5,8-9,13,18H,2,4,6-7,10-11H2,1H3,(H2,17,19,20) |
| InChIKey | WHYFVAADXMMFHS-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.46 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |