C40H43NSi2 — CID 141402840
2-[4-[1,3-bis(4-methylphenyl)-2-[4-(2-trimethylsilylethynyl)phenyl]-2,3-dihydropyrrol-5-yl]phenyl]ethynyl-trimethylsilane (PubChem CID 141402840) has the molecular formula C40H43NSi2 and a molecular weight of 593.96 g/mol. Its IUPAC name is 2-[4-[1,3-bis(4-methylphenyl)-2-[4-(2-trimethylsilylethynyl)phenyl]-2,3-dihydropyrrol-5-yl]phenyl]ethynyl-trimethylsilane.
| Compound Name | 2-[4-[1,3-bis(4-methylphenyl)-2-[4-(2-trimethylsilylethynyl)phenyl]-2,3-dihydropyrrol-5-yl]phenyl]ethynyl-trimethylsilane |
|---|---|
| PubChem CID | 141402840 |
| Molecular Formula | C40H43NSi2 |
| Molecular Weight | 593.96 g/mol |
| Exact Mass | 593.29 |
| IUPAC Name | 2-[4-[1,3-bis(4-methylphenyl)-2-[4-(2-trimethylsilylethynyl)phenyl]-2,3-dihydropyrrol-5-yl]phenyl]ethynyl-trimethylsilane |
| SMILES | Cc1ccc(C2C=C(c3ccc(C#C[Si](C)(C)C)cc3)N(c3ccc(C)cc3)C2c2ccc(C#C[Si](C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C40H43NSi2/c1-30-9-17-34(18-10-30)38-29-39(35-19-13-32(14-20-35)25-27-42(3,4)5)41(37-23-11-31(2)12-24-37)40(38)36-21-15-33(16-22-36)26-28-43(6,7)8/h9-24,29,38,40H,1-8H3 |
| InChIKey | JVURKBWJQDZLQS-UHFFFAOYSA-N |
| XLogP | 10.15 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.96 |
| LogP ≤ 5 | 10.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|