About 2-[5-(3-chlorophenyl)-1,3,4-thiadiazol-2-yl]guanidine
2-[5-(3-chlorophenyl)-1,3,4-thiadiazol-2-yl]guanidine (PubChem CID 14140336) has the molecular formula C9H8ClN5S
and a molecular weight of 253.72 g/mol. Its IUPAC name is 2-[5-(3-chlorophenyl)-1,3,4-thiadiazol-2-yl]guanidine.
Molecular Properties
| Compound Name | 2-[5-(3-chlorophenyl)-1,3,4-thiadiazol-2-yl]guanidine |
| PubChem CID | 14140336 |
| Molecular Formula | C9H8ClN5S |
| Molecular Weight | 253.72 g/mol |
| Exact Mass | 253.02 |
| IUPAC Name | 2-[5-(3-chlorophenyl)-1,3,4-thiadiazol-2-yl]guanidine |
| SMILES | NC(N)=Nc1nnc(-c2cccc(Cl)c2)s1 |
| InChI | InChI=1S/C9H8ClN5S/c10-6-3-1-2-5(4-6)7-14-15-9(16-7)13-8(11)12/h1-4H,(H4,11,12,13,15) |
| InChIKey | MOEMZGDHCUOXBP-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 90.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.72 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[5-(3-chlorophenyl)-1,3,4-thiadiazol-2-yl]guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[5-(3-chlorophenyl)-1,3,4-thiadiazol-2-yl]guanidine?
The IUPAC name of 2-[5-(3-chlorophenyl)-1,3,4-thiadiazol-2-yl]guanidine (CID 14140336) is 2-[5-(3-chlorophenyl)-1,3,4-thiadiazol-2-yl]guanidine.
What is the SMILES notation for 2-[5-(3-chlorophenyl)-1,3,4-thiadiazol-2-yl]guanidine?
The canonical SMILES for 2-[5-(3-chlorophenyl)-1,3,4-thiadiazol-2-yl]guanidine is NC(N)=Nc1nnc(-c2cccc(Cl)c2)s1.
What is the InChIKey of 2-[5-(3-chlorophenyl)-1,3,4-thiadiazol-2-yl]guanidine?
The InChIKey is MOEMZGDHCUOXBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8ClN5S/c10-6-3-1-2-5(4-6)7-14-15-9(16-7)13-8(11)12/h1-4H,(H4,11,12,13,15).
What are the key properties of 2-[5-(3-chlorophenyl)-1,3,4-thiadiazol-2-yl]guanidine?
2-[5-(3-chlorophenyl)-1,3,4-thiadiazol-2-yl]guanidine has a molecular weight of 253.72 g/mol, XLogP of 1.76, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-(3-chlorophenyl)-1,3,4-thiadiazol-2-yl]guanidine is sourced from PubChem (CID 14140336), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).